About 1-ethoxy-2-methylpropane;1-propoxypropane
1-ethoxy-2-methylpropane;1-propoxypropane (PubChem CID 174535854) has the molecular formula C12H28O2
and a molecular weight of 204.35 g/mol. Its IUPAC name is 1-ethoxy-2-methylpropane;1-propoxypropane.
Molecular Properties
| Compound Name | 1-ethoxy-2-methylpropane;1-propoxypropane |
| PubChem CID | 174535854 |
| Molecular Formula | C12H28O2 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.21 |
| IUPAC Name | 1-ethoxy-2-methylpropane;1-propoxypropane |
| SMILES | CCCOCCC.CCOCC(C)C |
| InChI | InChI=1S/2C6H14O/c1-4-7-5-6(2)3;1-3-5-7-6-4-2/h6H,4-5H2,1-3H3;3-6H2,1-2H3 |
| InChIKey | BEKGRHMQOYFIHP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-2-methylpropane;1-propoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-2-methylpropane;1-propoxypropane?
The IUPAC name of 1-ethoxy-2-methylpropane;1-propoxypropane (CID 174535854) is 1-ethoxy-2-methylpropane;1-propoxypropane.
What is the SMILES notation for 1-ethoxy-2-methylpropane;1-propoxypropane?
The canonical SMILES for 1-ethoxy-2-methylpropane;1-propoxypropane is CCCOCCC.CCOCC(C)C.
What is the InChIKey of 1-ethoxy-2-methylpropane;1-propoxypropane?
The InChIKey is BEKGRHMQOYFIHP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H14O/c1-4-7-5-6(2)3;1-3-5-7-6-4-2/h6H,4-5H2,1-3H3;3-6H2,1-2H3.
What are the key properties of 1-ethoxy-2-methylpropane;1-propoxypropane?
1-ethoxy-2-methylpropane;1-propoxypropane has a molecular weight of 204.35 g/mol, XLogP of 3.50, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-2-methylpropane;1-propoxypropane is sourced from PubChem (CID 174535854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).