About 1-ethoxypropane;1-propan-2-yloxypropane
1-ethoxypropane;1-propan-2-yloxypropane (PubChem CID 171659153) has the molecular formula C11H26O2
and a molecular weight of 190.33 g/mol. Its IUPAC name is 1-ethoxypropane;1-propan-2-yloxypropane.
Molecular Properties
| Compound Name | 1-ethoxypropane;1-propan-2-yloxypropane |
| PubChem CID | 171659153 |
| Molecular Formula | C11H26O2 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.19 |
| IUPAC Name | 1-ethoxypropane;1-propan-2-yloxypropane |
| SMILES | CCCOC(C)C.CCCOCC |
| InChI | InChI=1S/C6H14O.C5H12O/c1-4-5-7-6(2)3;1-3-5-6-4-2/h6H,4-5H2,1-3H3;3-5H2,1-2H3 |
| InChIKey | SAUUUYXGAKSYGP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxypropane;1-propan-2-yloxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxypropane;1-propan-2-yloxypropane?
The IUPAC name of 1-ethoxypropane;1-propan-2-yloxypropane (CID 171659153) is 1-ethoxypropane;1-propan-2-yloxypropane.
What is the SMILES notation for 1-ethoxypropane;1-propan-2-yloxypropane?
The canonical SMILES for 1-ethoxypropane;1-propan-2-yloxypropane is CCCOC(C)C.CCCOCC.
What is the InChIKey of 1-ethoxypropane;1-propan-2-yloxypropane?
The InChIKey is SAUUUYXGAKSYGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.C5H12O/c1-4-5-7-6(2)3;1-3-5-6-4-2/h6H,4-5H2,1-3H3;3-5H2,1-2H3.
What are the key properties of 1-ethoxypropane;1-propan-2-yloxypropane?
1-ethoxypropane;1-propan-2-yloxypropane has a molecular weight of 190.33 g/mol, XLogP of 3.25, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypropane;1-propan-2-yloxypropane is sourced from PubChem (CID 171659153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).