About 1-propan-2-yloxybutane;zirconium
1-propan-2-yloxybutane;zirconium (PubChem CID 174617524) has the molecular formula C7H16OZr
and a molecular weight of 207.43 g/mol. Its IUPAC name is 1-propan-2-yloxybutane;zirconium.
Molecular Properties
| Compound Name | 1-propan-2-yloxybutane;zirconium |
| PubChem CID | 174617524 |
| Molecular Formula | C7H16OZr |
| Molecular Weight | 207.43 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 1-propan-2-yloxybutane;zirconium |
| SMILES | CCCCOC(C)C.[Zr] |
| InChI | InChI=1S/C7H16O.Zr/c1-4-5-6-8-7(2)3;/h7H,4-6H2,1-3H3; |
| InChIKey | DJUOMNCMHDPOAV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-propan-2-yloxybutane;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yloxybutane;zirconium?
The IUPAC name of 1-propan-2-yloxybutane;zirconium (CID 174617524) is 1-propan-2-yloxybutane;zirconium.
What is the SMILES notation for 1-propan-2-yloxybutane;zirconium?
The canonical SMILES for 1-propan-2-yloxybutane;zirconium is CCCCOC(C)C.[Zr].
What is the InChIKey of 1-propan-2-yloxybutane;zirconium?
The InChIKey is DJUOMNCMHDPOAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O.Zr/c1-4-5-6-8-7(2)3;/h7H,4-6H2,1-3H3;.
What are the key properties of 1-propan-2-yloxybutane;zirconium?
1-propan-2-yloxybutane;zirconium has a molecular weight of 207.43 g/mol, XLogP of 2.21, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yloxybutane;zirconium is sourced from PubChem (CID 174617524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).