About azane;1-propan-2-yloxydodecane;sulfuric acid
azane;1-propan-2-yloxydodecane;sulfuric acid (PubChem CID 175080413) has the molecular formula C15H40N2O5S
and a molecular weight of 360.56 g/mol. Its IUPAC name is azane;1-propan-2-yloxydodecane;sulfuric acid.
Molecular Properties
| Compound Name | azane;1-propan-2-yloxydodecane;sulfuric acid |
| PubChem CID | 175080413 |
| Molecular Formula | C15H40N2O5S |
| Molecular Weight | 360.56 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | azane;1-propan-2-yloxydodecane;sulfuric acid |
| SMILES | CCCCCCCCCCCCOC(C)C.N.N.O=S(=O)(O)O |
| InChI | InChI=1S/C15H32O.2H3N.H2O4S/c1-4-5-6-7-8-9-10-11-12-13-14-16-15(2)3;;;1-5(2,3)4/h15H,4-14H2,1-3H3;2*1H3;(H2,1,2,3,4) |
| InChIKey | VNGKSBHVKOBFFA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 153.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;1-propan-2-yloxydodecane;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-propan-2-yloxydodecane;sulfuric acid?
The IUPAC name of azane;1-propan-2-yloxydodecane;sulfuric acid (CID 175080413) is azane;1-propan-2-yloxydodecane;sulfuric acid.
What is the SMILES notation for azane;1-propan-2-yloxydodecane;sulfuric acid?
The canonical SMILES for azane;1-propan-2-yloxydodecane;sulfuric acid is CCCCCCCCCCCCOC(C)C.N.N.O=S(=O)(O)O.
What is the InChIKey of azane;1-propan-2-yloxydodecane;sulfuric acid?
The InChIKey is VNGKSBHVKOBFFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O.2H3N.H2O4S/c1-4-5-6-7-8-9-10-11-12-13-14-16-15(2)3;;;1-5(2,3)4/h15H,4-14H2,1-3H3;2*1H3;(H2,1,2,3,4).
What are the key properties of azane;1-propan-2-yloxydodecane;sulfuric acid?
azane;1-propan-2-yloxydodecane;sulfuric acid has a molecular weight of 360.56 g/mol, XLogP of 5.00, 12 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-propan-2-yloxydodecane;sulfuric acid is sourced from PubChem (CID 175080413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).