About methane;1-propan-2-yloxybutane
methane;1-propan-2-yloxybutane (PubChem CID 158518476) has the molecular formula C9H24O
and a molecular weight of 148.29 g/mol. Its IUPAC name is methane;1-propan-2-yloxybutane.
Molecular Properties
| Compound Name | methane;1-propan-2-yloxybutane |
| PubChem CID | 158518476 |
| Molecular Formula | C9H24O |
| Molecular Weight | 148.29 g/mol |
| Exact Mass | 148.18 |
| IUPAC Name | methane;1-propan-2-yloxybutane |
| SMILES | C.C.CCCCOC(C)C |
| InChI | InChI=1S/C7H16O.2CH4/c1-4-5-6-8-7(2)3;;/h7H,4-6H2,1-3H3;2*1H4 |
| InChIKey | HLXPJILYBWLQSN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;1-propan-2-yloxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-propan-2-yloxybutane?
The IUPAC name of methane;1-propan-2-yloxybutane (CID 158518476) is methane;1-propan-2-yloxybutane.
What is the SMILES notation for methane;1-propan-2-yloxybutane?
The canonical SMILES for methane;1-propan-2-yloxybutane is C.C.CCCCOC(C)C.
What is the InChIKey of methane;1-propan-2-yloxybutane?
The InChIKey is HLXPJILYBWLQSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O.2CH4/c1-4-5-6-8-7(2)3;;/h7H,4-6H2,1-3H3;2*1H4.
What are the key properties of methane;1-propan-2-yloxybutane?
methane;1-propan-2-yloxybutane has a molecular weight of 148.29 g/mol, XLogP of 3.48, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-propan-2-yloxybutane is sourced from PubChem (CID 158518476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).