C19H46O4 — CID 157339053
1,3-di(propan-2-yloxy)propane;methane;2-(2-propan-2-yloxyethoxy)propane (PubChem CID 157339053) has the molecular formula C19H46O4 and a molecular weight of 338.57 g/mol. Its IUPAC name is 1,3-di(propan-2-yloxy)propane;methane;2-(2-propan-2-yloxyethoxy)propane.
| Compound Name | 1,3-di(propan-2-yloxy)propane;methane;2-(2-propan-2-yloxyethoxy)propane |
|---|---|
| PubChem CID | 157339053 |
| Molecular Formula | C19H46O4 |
| Molecular Weight | 338.57 g/mol |
| Exact Mass | 338.34 |
| IUPAC Name | 1,3-di(propan-2-yloxy)propane;methane;2-(2-propan-2-yloxyethoxy)propane |
| SMILES | C.C.CC(C)OCCCOC(C)C.CC(C)OCCOC(C)C |
| InChI | InChI=1S/C9H20O2.C8H18O2.2CH4/c1-8(2)10-6-5-7-11-9(3)4;1-7(2)9-5-6-10-8(3)4;;/h8-9H,5-7H2,1-4H3;7-8H,5-6H2,1-4H3;2*1H4 |
| InChIKey | BGEJVGGJTTZRGH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|