C7H16O3 — CID 87074397
4-propan-2-yloxybutane-1,1-diol (PubChem CID 87074397) has the molecular formula C7H16O3 and a molecular weight of 148.20 g/mol. Its IUPAC name is 4-propan-2-yloxybutane-1,1-diol.
| Compound Name | 4-propan-2-yloxybutane-1,1-diol |
|---|---|
| PubChem CID | 87074397 |
| Molecular Formula | C7H16O3 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | 4-propan-2-yloxybutane-1,1-diol |
| SMILES | CC(C)OCCCC(O)O |
| InChI | InChI=1S/C7H16O3/c1-6(2)10-5-3-4-7(8)9/h6-9H,3-5H2,1-2H3 |
| InChIKey | GZUOVUXMFRXJHU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|