C15H33NO2 — CID 149384579
(1R,4S)-4-methyl-1-(2-methylpropylamino)-7-propan-2-yloxyheptan-1-ol (PubChem CID 149384579) has the molecular formula C15H33NO2 and a molecular weight of 259.43 g/mol. Its IUPAC name is (1R,4S)-4-methyl-1-(2-methylpropylamino)-7-propan-2-yloxyheptan-1-ol.
| Compound Name | (1R,4S)-4-methyl-1-(2-methylpropylamino)-7-propan-2-yloxyheptan-1-ol |
|---|---|
| PubChem CID | 149384579 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | (1R,4S)-4-methyl-1-(2-methylpropylamino)-7-propan-2-yloxyheptan-1-ol |
| SMILES | CC(C)CN[C@H](O)CC[C@@H](C)CCCOC(C)C |
| InChI | InChI=1S/C15H33NO2/c1-12(2)11-16-15(17)9-8-14(5)7-6-10-18-13(3)4/h12-17H,6-11H2,1-5H3/t14-,15+/m0/s1 |
| InChIKey | YMIFAVUJUQCCRW-LSDHHAIUSA-N |
| XLogP | 3.17 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|