C23H48O2 — CID 162457350
6-(3,7-dimethyloctoxy)-3,7-dimethyl-1-propan-2-yloxyoctane (PubChem CID 162457350) has the molecular formula C23H48O2 and a molecular weight of 356.64 g/mol. Its IUPAC name is 6-(3,7-dimethyloctoxy)-3,7-dimethyl-1-propan-2-yloxyoctane.
| Compound Name | 6-(3,7-dimethyloctoxy)-3,7-dimethyl-1-propan-2-yloxyoctane |
|---|---|
| PubChem CID | 162457350 |
| Molecular Formula | C23H48O2 |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 356.37 |
| IUPAC Name | 6-(3,7-dimethyloctoxy)-3,7-dimethyl-1-propan-2-yloxyoctane |
| SMILES | CC(C)CCCC(C)CCOC(CCC(C)CCOC(C)C)C(C)C |
| InChI | InChI=1S/C23H48O2/c1-18(2)10-9-11-21(7)15-17-25-23(19(3)4)13-12-22(8)14-16-24-20(5)6/h18-23H,9-17H2,1-8H3 |
| InChIKey | FCSCFYUKVDYCTC-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |