C11H24O — CID 155609202
3,5-dimethyl-1-propan-2-yloxyhexane (PubChem CID 155609202) has the molecular formula C11H24O and a molecular weight of 172.31 g/mol. Its IUPAC name is 3,5-dimethyl-1-propan-2-yloxyhexane.
| Compound Name | 3,5-dimethyl-1-propan-2-yloxyhexane |
|---|---|
| PubChem CID | 155609202 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | 3,5-dimethyl-1-propan-2-yloxyhexane |
| SMILES | CC(C)CC(C)CCOC(C)C |
| InChI | InChI=1S/C11H24O/c1-9(2)8-11(5)6-7-12-10(3)4/h9-11H,6-8H2,1-5H3 |
| InChIKey | FJLQQQOMSWVKQU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |