C38H78O3 — CID 18609816
3-[(7R,11R)-3,7,11,15-tetramethylhexadecoxy]-2-(3,7,11-trimethyldodecoxy)propan-1-ol (PubChem CID 18609816) has the molecular formula C38H78O3 and a molecular weight of 583.04 g/mol. Its IUPAC name is 3-[(7R,11R)-3,7,11,15-tetramethylhexadecoxy]-2-(3,7,11-trimethyldodecoxy)propan-1-ol.
| Compound Name | 3-[(7R,11R)-3,7,11,15-tetramethylhexadecoxy]-2-(3,7,11-trimethyldodecoxy)propan-1-ol |
|---|---|
| PubChem CID | 18609816 |
| Molecular Formula | C38H78O3 |
| Molecular Weight | 583.04 g/mol |
| Exact Mass | 582.60 |
| IUPAC Name | 3-[(7R,11R)-3,7,11,15-tetramethylhexadecoxy]-2-(3,7,11-trimethyldodecoxy)propan-1-ol |
| SMILES | CC(C)CCCC(C)CCCC(C)CCOC(CO)COCCC(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C38H78O3/c1-31(2)15-10-17-33(5)19-12-20-35(7)22-13-23-36(8)25-27-40-30-38(29-39)41-28-26-37(9)24-14-21-34(6)18-11-16-32(3)4/h31-39H,10-30H2,1-9H3/t33-,34?,35-,36?,37?,38?/m1/s1 |
| InChIKey | RHYVLWMABKNHTA-LNMNNLOQSA-N |
| XLogP | 11.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.04 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|