C32H64O3 — CID 168868394
3-non-8-enoxy-2-[(7R,11R)-3,7,11,15-tetramethylhexadecoxy]propan-1-ol (PubChem CID 168868394) has the molecular formula C32H64O3 and a molecular weight of 496.86 g/mol. Its IUPAC name is 3-non-8-enoxy-2-[(7R,11R)-3,7,11,15-tetramethylhexadecoxy]propan-1-ol.
| Compound Name | 3-non-8-enoxy-2-[(7R,11R)-3,7,11,15-tetramethylhexadecoxy]propan-1-ol |
|---|---|
| PubChem CID | 168868394 |
| Molecular Formula | C32H64O3 |
| Molecular Weight | 496.86 g/mol |
| Exact Mass | 496.49 |
| IUPAC Name | 3-non-8-enoxy-2-[(7R,11R)-3,7,11,15-tetramethylhexadecoxy]propan-1-ol |
| SMILES | C=CCCCCCCCOCC(CO)OCCC(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C32H64O3/c1-7-8-9-10-11-12-13-24-34-27-32(26-33)35-25-23-31(6)22-16-21-30(5)20-15-19-29(4)18-14-17-28(2)3/h7,28-33H,1,8-27H2,2-6H3/t29-,30-,31?,32?/m1/s1 |
| InChIKey | KXHLPFWVGVIMSL-NXFCCEIPSA-N |
| XLogP | 9.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.86 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|