C38H78O3 — CID 54669600
(2R)-2-[(3R,7R)-3,7,15-trimethylhexadecoxy]-3-[(3S,7R,11S)-3,7,11-trimethyltridecoxy]propan-1-ol (PubChem CID 54669600) has the molecular formula C38H78O3 and a molecular weight of 583.04 g/mol. Its IUPAC name is (2R)-2-[(3R,7R)-3,7,15-trimethylhexadecoxy]-3-[(3S,7R,11S)-3,7,11-trimethyltridecoxy]propan-1-ol.
| Compound Name | (2R)-2-[(3R,7R)-3,7,15-trimethylhexadecoxy]-3-[(3S,7R,11S)-3,7,11-trimethyltridecoxy]propan-1-ol |
|---|---|
| PubChem CID | 54669600 |
| Molecular Formula | C38H78O3 |
| Molecular Weight | 583.04 g/mol |
| Exact Mass | 582.60 |
| IUPAC Name | (2R)-2-[(3R,7R)-3,7,15-trimethylhexadecoxy]-3-[(3S,7R,11S)-3,7,11-trimethyltridecoxy]propan-1-ol |
| SMILES | CC[C@H](C)CCC[C@@H](C)CCC[C@H](C)CCOC[C@@H](CO)OCC[C@H](C)CCC[C@H](C)CCCCCCCC(C)C |
| InChI | InChI=1S/C38H78O3/c1-9-33(4)20-15-21-35(6)23-17-24-36(7)26-28-40-31-38(30-39)41-29-27-37(8)25-16-22-34(5)19-14-12-10-11-13-18-32(2)3/h32-39H,9-31H2,1-8H3/t33-,34+,35+,36-,37+,38+/m0/s1 |
| InChIKey | KSEIPBJSHMAFIO-CDQOGRMBSA-N |
| XLogP | 11.65 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.04 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|