C49H98O8 — CID 54364234
(3R,4S,5S,6R)-2-[2,3-bis(3,7,11,15-tetramethylhexadecoxy)propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 54364234) has the molecular formula C49H98O8 and a molecular weight of 815.31 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[2,3-bis(3,7,11,15-tetramethylhexadecoxy)propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4S,5S,6R)-2-[2,3-bis(3,7,11,15-tetramethylhexadecoxy)propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 54364234 |
| Molecular Formula | C49H98O8 |
| Molecular Weight | 815.31 g/mol |
| Exact Mass | 814.73 |
| IUPAC Name | (3R,4S,5S,6R)-2-[2,3-bis(3,7,11,15-tetramethylhexadecoxy)propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCOCC(COC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)OCCC(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C49H98O8/c1-36(2)17-11-19-38(5)21-13-23-40(7)25-15-27-42(9)29-31-54-34-44(35-56-49-48(53)47(52)46(51)45(33-50)57-49)55-32-30-43(10)28-16-26-41(8)24-14-22-39(6)20-12-18-37(3)4/h36-53H,11-35H2,1-10H3/t38?,39?,40?,41?,42?,43?,44?,45-,46-,47+,48-,49?/m1/s1 |
| InChIKey | UOQHWSSSRAZWSQ-PHFGSYOCSA-N |
| XLogP | 11.14 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.31 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|