C20H42O6 — CID 102323659
2-[2-[2-[2-[2-(3,7-dimethyloctoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 102323659) has the molecular formula C20H42O6 and a molecular weight of 378.55 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(3,7-dimethyloctoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[2-(3,7-dimethyloctoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 102323659 |
| Molecular Formula | C20H42O6 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | 2-[2-[2-[2-[2-(3,7-dimethyloctoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | CC(C)CCCC(C)CCOCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C20H42O6/c1-19(2)5-4-6-20(3)7-9-22-11-13-24-15-17-26-18-16-25-14-12-23-10-8-21/h19-21H,4-18H2,1-3H3 |
| InChIKey | HKVAWHQUYXVARE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|