C13H30O9S — CID 87749078
2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]ethanol;sulfuric acid (PubChem CID 87749078) has the molecular formula C13H30O9S and a molecular weight of 362.44 g/mol. Its IUPAC name is 2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]ethanol;sulfuric acid.
| Compound Name | 2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]ethanol;sulfuric acid |
|---|---|
| PubChem CID | 87749078 |
| Molecular Formula | C13H30O9S |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]ethanol;sulfuric acid |
| SMILES | CC(C)CCOCCOCCOCCOCCO.O=S(=O)(O)O |
| InChI | InChI=1S/C13H28O5.H2O4S/c1-13(2)3-5-15-7-9-17-11-12-18-10-8-16-6-4-14;1-5(2,3)4/h13-14H,3-12H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | XNYURXMQKWIJBM-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|