About 2-methanidyl-2-methylpropane;2-(3-methylbutoxy)ethanol;yttrium
2-methanidyl-2-methylpropane;2-(3-methylbutoxy)ethanol;yttrium (PubChem CID 166008404) has the molecular formula C12H27O2Y-
and a molecular weight of 292.25 g/mol. Its IUPAC name is 2-methanidyl-2-methylpropane;2-(3-methylbutoxy)ethanol;yttrium.
Molecular Properties
| Compound Name | 2-methanidyl-2-methylpropane;2-(3-methylbutoxy)ethanol;yttrium |
| PubChem CID | 166008404 |
| Molecular Formula | C12H27O2Y- |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-methanidyl-2-methylpropane;2-(3-methylbutoxy)ethanol;yttrium |
| SMILES | CC(C)CCOCCO.[CH2-]C(C)(C)C.[Y] |
| InChI | InChI=1S/C7H16O2.C5H11.Y/c1-7(2)3-5-9-6-4-8;1-5(2,3)4;/h7-8H,3-6H2,1-2H3;1H2,2-4H3;/q;-1; |
| InChIKey | UQVFYVMLFJSOSB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methanidyl-2-methylpropane;2-(3-methylbutoxy)ethanol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanidyl-2-methylpropane;2-(3-methylbutoxy)ethanol;yttrium?
The IUPAC name of 2-methanidyl-2-methylpropane;2-(3-methylbutoxy)ethanol;yttrium (CID 166008404) is 2-methanidyl-2-methylpropane;2-(3-methylbutoxy)ethanol;yttrium.
What is the SMILES notation for 2-methanidyl-2-methylpropane;2-(3-methylbutoxy)ethanol;yttrium?
The canonical SMILES for 2-methanidyl-2-methylpropane;2-(3-methylbutoxy)ethanol;yttrium is CC(C)CCOCCO.[CH2-]C(C)(C)C.[Y].
What is the InChIKey of 2-methanidyl-2-methylpropane;2-(3-methylbutoxy)ethanol;yttrium?
The InChIKey is UQVFYVMLFJSOSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O2.C5H11.Y/c1-7(2)3-5-9-6-4-8;1-5(2,3)4;/h7-8H,3-6H2,1-2H3;1H2,2-4H3;/q;-1;.
What are the key properties of 2-methanidyl-2-methylpropane;2-(3-methylbutoxy)ethanol;yttrium?
2-methanidyl-2-methylpropane;2-(3-methylbutoxy)ethanol;yttrium has a molecular weight of 292.25 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanidyl-2-methylpropane;2-(3-methylbutoxy)ethanol;yttrium is sourced from PubChem (CID 166008404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).