C13H28O3S2 — CID 177289189
2-[3-[3-(3-methylbutoxy)propyldisulfanyl]propoxy]ethanol (PubChem CID 177289189) has the molecular formula C13H28O3S2 and a molecular weight of 296.50 g/mol. Its IUPAC name is 2-[3-[3-(3-methylbutoxy)propyldisulfanyl]propoxy]ethanol.
| Compound Name | 2-[3-[3-(3-methylbutoxy)propyldisulfanyl]propoxy]ethanol |
|---|---|
| PubChem CID | 177289189 |
| Molecular Formula | C13H28O3S2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-[3-[3-(3-methylbutoxy)propyldisulfanyl]propoxy]ethanol |
| SMILES | CC(C)CCOCCCSSCCCOCCO |
| InChI | InChI=1S/C13H28O3S2/c1-13(2)5-9-15-7-3-11-17-18-12-4-8-16-10-6-14/h13-14H,3-12H2,1-2H3 |
| InChIKey | VDXNGMHMIZKHPE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|