C15H32O4 — CID 545734
2-[2-[2-(3,5,5-trimethylhexoxy)ethoxy]ethoxy]ethanol (PubChem CID 545734) has the molecular formula C15H32O4 and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-[2-[2-(3,5,5-trimethylhexoxy)ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-(3,5,5-trimethylhexoxy)ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 545734 |
| Molecular Formula | C15H32O4 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 2-[2-[2-(3,5,5-trimethylhexoxy)ethoxy]ethoxy]ethanol |
| SMILES | CC(CCOCCOCCOCCO)CC(C)(C)C |
| InChI | InChI=1S/C15H32O4/c1-14(13-15(2,3)4)5-7-17-9-11-19-12-10-18-8-6-16/h14,16H,5-13H2,1-4H3 |
| InChIKey | CQOVUZIFCWPUOD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|