C19H38O7 — CID 89103547
2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl 3,5,5-trimethylhexanoate (PubChem CID 89103547) has the molecular formula C19H38O7 and a molecular weight of 378.51 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl 3,5,5-trimethylhexanoate.
| Compound Name | 2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl 3,5,5-trimethylhexanoate |
|---|---|
| PubChem CID | 89103547 |
| Molecular Formula | C19H38O7 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl 3,5,5-trimethylhexanoate |
| SMILES | CC(CC(=O)OCCOCCOCCOCCOCCO)CC(C)(C)C |
| InChI | InChI=1S/C19H38O7/c1-17(16-19(2,3)4)15-18(21)26-14-13-25-12-11-24-10-9-23-8-7-22-6-5-20/h17,20H,5-16H2,1-4H3 |
| InChIKey | ISXDFBDVDMKRFZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|