C20H38O4 — CID 91728705
2-(3,5,5-trimethylhexanoyloxy)ethyl 3,5,5-trimethylhexanoate (PubChem CID 91728705) has the molecular formula C20H38O4 and a molecular weight of 342.52 g/mol. Its IUPAC name is 2-(3,5,5-trimethylhexanoyloxy)ethyl 3,5,5-trimethylhexanoate.
| Compound Name | 2-(3,5,5-trimethylhexanoyloxy)ethyl 3,5,5-trimethylhexanoate |
|---|---|
| PubChem CID | 91728705 |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | 2-(3,5,5-trimethylhexanoyloxy)ethyl 3,5,5-trimethylhexanoate |
| SMILES | CC(CC(=O)OCCOC(=O)CC(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C20H38O4/c1-15(13-19(3,4)5)11-17(21)23-9-10-24-18(22)12-16(2)14-20(6,7)8/h15-16H,9-14H2,1-8H3 |
| InChIKey | VMWGCKHVNGTNLU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|