C9H17ClO — CID 7171810
(3R)-3,5,5-trimethylhexanoyl chloride (PubChem CID 7171810) has the molecular formula C9H17ClO and a molecular weight of 176.69 g/mol. Its IUPAC name is (3R)-3,5,5-trimethylhexanoyl chloride.
| Compound Name | (3R)-3,5,5-trimethylhexanoyl chloride |
|---|---|
| PubChem CID | 7171810 |
| Molecular Formula | C9H17ClO |
| Molecular Weight | 176.69 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (3R)-3,5,5-trimethylhexanoyl chloride |
| SMILES | C[C@@H](CC(=O)Cl)CC(C)(C)C |
| InChI | InChI=1S/C9H17ClO/c1-7(5-8(10)11)6-9(2,3)4/h7H,5-6H2,1-4H3/t7-/m0/s1 |
| InChIKey | GEKPNPPFAYJZRD-ZETCQYMHSA-N |
| XLogP | 3.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.69 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|