C14H27ClO — CID 71389962
2,2-diethyl-4,6,6-trimethylheptanoyl chloride (PubChem CID 71389962) has the molecular formula C14H27ClO and a molecular weight of 246.82 g/mol. Its IUPAC name is 2,2-diethyl-4,6,6-trimethylheptanoyl chloride.
| Compound Name | 2,2-diethyl-4,6,6-trimethylheptanoyl chloride |
|---|---|
| PubChem CID | 71389962 |
| Molecular Formula | C14H27ClO |
| Molecular Weight | 246.82 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 2,2-diethyl-4,6,6-trimethylheptanoyl chloride |
| SMILES | CCC(CC)(CC(C)CC(C)(C)C)C(=O)Cl |
| InChI | InChI=1S/C14H27ClO/c1-7-14(8-2,12(15)16)10-11(3)9-13(4,5)6/h11H,7-10H2,1-6H3 |
| InChIKey | XVOZDMCZWIXQLO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.82 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|