C18H34O4Zn — CID 20846402
zinc bis(3,5,5-trimethylhexanoate) (PubChem CID 20846402) has the molecular formula C18H34O4Zn and a molecular weight of 379.86 g/mol. Its IUPAC name is zinc bis(3,5,5-trimethylhexanoate).
| Compound Name | zinc bis(3,5,5-trimethylhexanoate) |
|---|---|
| PubChem CID | 20846402 |
| Molecular Formula | C18H34O4Zn |
| Molecular Weight | 379.86 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | zinc bis(3,5,5-trimethylhexanoate) |
| SMILES | CC(CC(=O)[O-])CC(C)(C)C.CC(CC(=O)[O-])CC(C)(C)C.[Zn+2] |
| InChI | InChI=1S/2C9H18O2.Zn/c2*1-7(5-8(10)11)6-9(2,3)4;/h2*7H,5-6H2,1-4H3,(H,10,11);/q;;+2/p-2 |
| InChIKey | WNBIEHBTBOSHDF-UHFFFAOYSA-L |
| XLogP | 2.39 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.86 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|