C12H24ClNO — CID 106441524
N-(2-chloroethyl)-N,3,5,5-tetramethylhexanamide (PubChem CID 106441524) has the molecular formula C12H24ClNO and a molecular weight of 233.78 g/mol. Its IUPAC name is N-(2-chloroethyl)-N,3,5,5-tetramethylhexanamide.
| Compound Name | N-(2-chloroethyl)-N,3,5,5-tetramethylhexanamide |
|---|---|
| PubChem CID | 106441524 |
| Molecular Formula | C12H24ClNO |
| Molecular Weight | 233.78 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | N-(2-chloroethyl)-N,3,5,5-tetramethylhexanamide |
| SMILES | CC(CC(=O)N(C)CCCl)CC(C)(C)C |
| InChI | InChI=1S/C12H24ClNO/c1-10(9-12(2,3)4)8-11(15)14(5)7-6-13/h10H,6-9H2,1-5H3 |
| InChIKey | UZNIFMCSCUVJSE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.78 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|