C14H28ClNO — CID 107205672
N-(5-chloropentyl)-N,3,4,4-tetramethylpentanamide (PubChem CID 107205672) has the molecular formula C14H28ClNO and a molecular weight of 261.84 g/mol. Its IUPAC name is N-(5-chloropentyl)-N,3,4,4-tetramethylpentanamide.
| Compound Name | N-(5-chloropentyl)-N,3,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 107205672 |
| Molecular Formula | C14H28ClNO |
| Molecular Weight | 261.84 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | N-(5-chloropentyl)-N,3,4,4-tetramethylpentanamide |
| SMILES | CC(CC(=O)N(C)CCCCCCl)C(C)(C)C |
| InChI | InChI=1S/C14H28ClNO/c1-12(14(2,3)4)11-13(17)16(5)10-8-6-7-9-15/h12H,6-11H2,1-5H3 |
| InChIKey | OFMJJPFFMWSJGS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.84 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|