C14H26N2O — CID 63224542
N-(1-cyanopropan-2-yl)-N,3,5,5-tetramethylhexanamide (PubChem CID 63224542) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is N-(1-cyanopropan-2-yl)-N,3,5,5-tetramethylhexanamide.
| Compound Name | N-(1-cyanopropan-2-yl)-N,3,5,5-tetramethylhexanamide |
|---|---|
| PubChem CID | 63224542 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | N-(1-cyanopropan-2-yl)-N,3,5,5-tetramethylhexanamide |
| SMILES | CC(CC(=O)N(C)C(C)CC#N)CC(C)(C)C |
| InChI | InChI=1S/C14H26N2O/c1-11(10-14(3,4)5)9-13(17)16(6)12(2)7-8-15/h11-12H,7,9-10H2,1-6H3 |
| InChIKey | NVFWVJFYPZUKGO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |