C10H18N2O — CID 114874733
N-(1-cyanoethyl)-N,3-dimethylpentanamide (PubChem CID 114874733) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is N-(1-cyanoethyl)-N,3-dimethylpentanamide.
| Compound Name | N-(1-cyanoethyl)-N,3-dimethylpentanamide |
|---|---|
| PubChem CID | 114874733 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | N-(1-cyanoethyl)-N,3-dimethylpentanamide |
| SMILES | CCC(C)CC(=O)N(C)C(C)C#N |
| InChI | InChI=1S/C10H18N2O/c1-5-8(2)6-10(13)12(4)9(3)7-11/h8-9H,5-6H2,1-4H3 |
| InChIKey | RUOLVARXMDYJPH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |