C10H22N2O — CID 81072119
4-amino-N-butan-2-yl-N,3-dimethylbutanamide (PubChem CID 81072119) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 4-amino-N-butan-2-yl-N,3-dimethylbutanamide.
| Compound Name | 4-amino-N-butan-2-yl-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 81072119 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 4-amino-N-butan-2-yl-N,3-dimethylbutanamide |
| SMILES | CCC(C)N(C)C(=O)CC(C)CN |
| InChI | InChI=1S/C10H22N2O/c1-5-9(3)12(4)10(13)6-8(2)7-11/h8-9H,5-7,11H2,1-4H3 |
| InChIKey | VMUAGJIVXAIIEO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |