C12H26N2O — CID 115737332
N-(1-aminopropan-2-yl)-N,3,4,4-tetramethylpentanamide (PubChem CID 115737332) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-N,3,4,4-tetramethylpentanamide.
| Compound Name | N-(1-aminopropan-2-yl)-N,3,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 115737332 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N-(1-aminopropan-2-yl)-N,3,4,4-tetramethylpentanamide |
| SMILES | CC(CN)N(C)C(=O)CC(C)C(C)(C)C |
| InChI | InChI=1S/C12H26N2O/c1-9(12(3,4)5)7-11(15)14(6)10(2)8-13/h9-10H,7-8,13H2,1-6H3 |
| InChIKey | UJIQKWRQSABLLH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |