C11H23NO2 — CID 63834183
N-(2-hydroxyethyl)-N,3,4,4-tetramethylpentanamide (PubChem CID 63834183) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N,3,4,4-tetramethylpentanamide.
| Compound Name | N-(2-hydroxyethyl)-N,3,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 63834183 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | N-(2-hydroxyethyl)-N,3,4,4-tetramethylpentanamide |
| SMILES | CC(CC(=O)N(C)CCO)C(C)(C)C |
| InChI | InChI=1S/C11H23NO2/c1-9(11(2,3)4)8-10(14)12(5)6-7-13/h9,13H,6-8H2,1-5H3 |
| InChIKey | UZGLCCQVZGMNCP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |