C13H23N3O — CID 63939448
N-(1H-imidazol-2-ylmethyl)-N,3,4,4-tetramethylpentanamide (PubChem CID 63939448) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)-N,3,4,4-tetramethylpentanamide.
| Compound Name | N-(1H-imidazol-2-ylmethyl)-N,3,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 63939448 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)-N,3,4,4-tetramethylpentanamide |
| SMILES | CC(CC(=O)N(C)Cc1ncc[nH]1)C(C)(C)C |
| InChI | InChI=1S/C13H23N3O/c1-10(13(2,3)4)8-12(17)16(5)9-11-14-6-7-15-11/h6-7,10H,8-9H2,1-5H3,(H,14,15) |
| InChIKey | LOQHCJHYSWUDDL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |