C13H24N4O — CID 65291202
6-amino-N-(1H-imidazol-2-ylmethyl)-N,2-dimethylheptanamide (PubChem CID 65291202) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 6-amino-N-(1H-imidazol-2-ylmethyl)-N,2-dimethylheptanamide.
| Compound Name | 6-amino-N-(1H-imidazol-2-ylmethyl)-N,2-dimethylheptanamide |
|---|---|
| PubChem CID | 65291202 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 6-amino-N-(1H-imidazol-2-ylmethyl)-N,2-dimethylheptanamide |
| SMILES | CC(N)CCCC(C)C(=O)N(C)Cc1ncc[nH]1 |
| InChI | InChI=1S/C13H24N4O/c1-10(5-4-6-11(2)14)13(18)17(3)9-12-15-7-8-16-12/h7-8,10-11H,4-6,9,14H2,1-3H3,(H,15,16) |
| InChIKey | SIMCBAJRKQSENT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |