C13H27NO2 — CID 115771733
N-ethyl-N-(3-hydroxypropyl)-3,4,4-trimethylpentanamide (PubChem CID 115771733) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is N-ethyl-N-(3-hydroxypropyl)-3,4,4-trimethylpentanamide.
| Compound Name | N-ethyl-N-(3-hydroxypropyl)-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 115771733 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | N-ethyl-N-(3-hydroxypropyl)-3,4,4-trimethylpentanamide |
| SMILES | CCN(CCCO)C(=O)CC(C)C(C)(C)C |
| InChI | InChI=1S/C13H27NO2/c1-6-14(8-7-9-15)12(16)10-11(2)13(3,4)5/h11,15H,6-10H2,1-5H3 |
| InChIKey | XOEYVBMEPPSELF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |