C8H15NO2 — CID 142974327
N-formyl-N,3-dimethylpentanamide (PubChem CID 142974327) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is N-formyl-N,3-dimethylpentanamide.
| Compound Name | N-formyl-N,3-dimethylpentanamide |
|---|---|
| PubChem CID | 142974327 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | N-formyl-N,3-dimethylpentanamide |
| SMILES | CCC(C)CC(=O)N(C)C=O |
| InChI | InChI=1S/C8H15NO2/c1-4-7(2)5-8(11)9(3)6-10/h6-7H,4-5H2,1-3H3 |
| InChIKey | KCSIGRDMMZRMKI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|