C11H22ClNO2 — CID 114876844
N-(2-chloro-3-methoxypropyl)-N,3-dimethylpentanamide (PubChem CID 114876844) has the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. Its IUPAC name is N-(2-chloro-3-methoxypropyl)-N,3-dimethylpentanamide.
| Compound Name | N-(2-chloro-3-methoxypropyl)-N,3-dimethylpentanamide |
|---|---|
| PubChem CID | 114876844 |
| Molecular Formula | C11H22ClNO2 |
| Molecular Weight | 235.75 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | N-(2-chloro-3-methoxypropyl)-N,3-dimethylpentanamide |
| SMILES | CCC(C)CC(=O)N(C)CC(Cl)COC |
| InChI | InChI=1S/C11H22ClNO2/c1-5-9(2)6-11(14)13(3)7-10(12)8-15-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | LFDXWKLPGQEUNY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.75 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|