C12H26N2O — CID 107206770
N-(5-aminopentyl)-N,3-dimethylpentanamide (PubChem CID 107206770) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is N-(5-aminopentyl)-N,3-dimethylpentanamide.
| Compound Name | N-(5-aminopentyl)-N,3-dimethylpentanamide |
|---|---|
| PubChem CID | 107206770 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N-(5-aminopentyl)-N,3-dimethylpentanamide |
| SMILES | CCC(C)CC(=O)N(C)CCCCCN |
| InChI | InChI=1S/C12H26N2O/c1-4-11(2)10-12(15)14(3)9-7-5-6-8-13/h11H,4-10,13H2,1-3H3 |
| InChIKey | XYUJVXJLIKZQNO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|