C10H19F3N2O — CID 107206525
N-(5-aminopentyl)-4,4,4-trifluoro-N-methylbutanamide (PubChem CID 107206525) has the molecular formula C10H19F3N2O and a molecular weight of 240.27 g/mol. Its IUPAC name is N-(5-aminopentyl)-4,4,4-trifluoro-N-methylbutanamide.
| Compound Name | N-(5-aminopentyl)-4,4,4-trifluoro-N-methylbutanamide |
|---|---|
| PubChem CID | 107206525 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N-(5-aminopentyl)-4,4,4-trifluoro-N-methylbutanamide |
| SMILES | CN(CCCCCN)C(=O)CCC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O/c1-15(8-4-2-3-7-14)9(16)5-6-10(11,12)13/h2-8,14H2,1H3 |
| InChIKey | RVGNGFUYZGZGAR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|