C11H21F3N2O2 — CID 82788019
N-(3-aminopropyl)-N-methyl-3-(4,4,4-trifluorobutoxy)propanamide (PubChem CID 82788019) has the molecular formula C11H21F3N2O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-methyl-3-(4,4,4-trifluorobutoxy)propanamide.
| Compound Name | N-(3-aminopropyl)-N-methyl-3-(4,4,4-trifluorobutoxy)propanamide |
|---|---|
| PubChem CID | 82788019 |
| Molecular Formula | C11H21F3N2O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | N-(3-aminopropyl)-N-methyl-3-(4,4,4-trifluorobutoxy)propanamide |
| SMILES | CN(CCCN)C(=O)CCOCCCC(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O2/c1-16(7-3-6-15)10(17)4-9-18-8-2-5-11(12,13)14/h2-9,15H2,1H3 |
| InChIKey | FXUPGJZUENMWHJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|