C8H13ClF3NO2 — CID 103212140
N-(2-chloroethyl)-N-methyl-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 103212140) has the molecular formula C8H13ClF3NO2 and a molecular weight of 247.64 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-methyl-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(2-chloroethyl)-N-methyl-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103212140 |
| Molecular Formula | C8H13ClF3NO2 |
| Molecular Weight | 247.64 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | N-(2-chloroethyl)-N-methyl-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CN(CCCl)C(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C8H13ClF3NO2/c1-13(4-3-9)7(14)2-5-15-6-8(10,11)12/h2-6H2,1H3 |
| InChIKey | SUTJCTCEOXRBBJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.64 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|