C12H19ClF3NO2 — CID 103212868
N-(3-chloropropyl)-N-cyclobutyl-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 103212868) has the molecular formula C12H19ClF3NO2 and a molecular weight of 301.74 g/mol. Its IUPAC name is N-(3-chloropropyl)-N-cyclobutyl-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(3-chloropropyl)-N-cyclobutyl-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103212868 |
| Molecular Formula | C12H19ClF3NO2 |
| Molecular Weight | 301.74 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-(3-chloropropyl)-N-cyclobutyl-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)(F)F)N(CCCCl)C1CCC1 |
| InChI | InChI=1S/C12H19ClF3NO2/c13-6-2-7-17(10-3-1-4-10)11(18)5-8-19-9-12(14,15)16/h10H,1-9H2 |
| InChIKey | DSNBROZPLWPGKE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.74 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|