C11H22F2N2O2 — CID 107206665
N-(5-aminopentyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide (PubChem CID 107206665) has the molecular formula C11H22F2N2O2 and a molecular weight of 252.30 g/mol. Its IUPAC name is N-(5-aminopentyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide.
| Compound Name | N-(5-aminopentyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide |
|---|---|
| PubChem CID | 107206665 |
| Molecular Formula | C11H22F2N2O2 |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-(5-aminopentyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide |
| SMILES | CN(CCCCCN)C(=O)CCOCC(F)F |
| InChI | InChI=1S/C11H22F2N2O2/c1-15(7-4-2-3-6-14)11(16)5-8-17-9-10(12)13/h10H,2-9,14H2,1H3 |
| InChIKey | UGTPMXPABPPXRE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|