2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid

C8H13F2NO4 — CID 103205785

IUPAC2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid
SMILESCN(CC(=O)O)C(=O)CCOCC(F)F
InChIInChI=1S/C8H13F2NO4/c1-11(4-8(13)14)7(12)2-3-15-5-6(9)10/h6H,2-5H2,1H3,(H,13,14)
InChIKeyUQSGQLKIKBUJNE-UHFFFAOYSA-N
MW225.19 g/mol
LogP0.20
Rot. Bonds7

About 2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid

2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid (PubChem CID 103205785) has the molecular formula C8H13F2NO4 and a molecular weight of 225.19 g/mol. Its IUPAC name is 2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid.

Molecular Properties

Compound Name2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid
PubChem CID103205785
Molecular FormulaC8H13F2NO4
Molecular Weight225.19 g/mol
Exact Mass225.08
IUPAC Name2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid
SMILESCN(CC(=O)O)C(=O)CCOCC(F)F
InChIInChI=1S/C8H13F2NO4/c1-11(4-8(13)14)7(12)2-3-15-5-6(9)10/h6H,2-5H2,1H3,(H,13,14)
InChIKeyUQSGQLKIKBUJNE-UHFFFAOYSA-N
XLogP0.20
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.19
LogP ≤ 50.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid?
The IUPAC name of 2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid (CID 103205785) is 2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid.
What is the SMILES notation for 2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid?
The canonical SMILES for 2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid is CN(CC(=O)O)C(=O)CCOCC(F)F.
What is the InChIKey of 2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid?
The InChIKey is UQSGQLKIKBUJNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO4/c1-11(4-8(13)14)7(12)2-3-15-5-6(9)10/h6H,2-5H2,1H3,(H,13,14).
What are the key properties of 2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid?
2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid has a molecular weight of 225.19 g/mol, XLogP of 0.20, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid is sourced from PubChem (CID 103205785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).