C8H13F2NO4 — CID 103205785
2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid (PubChem CID 103205785) has the molecular formula C8H13F2NO4 and a molecular weight of 225.19 g/mol. Its IUPAC name is 2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid.
| Compound Name | 2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 103205785 |
| Molecular Formula | C8H13F2NO4 |
| Molecular Weight | 225.19 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-[3-(2,2-difluoroethoxy)propanoyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)CCOCC(F)F |
| InChI | InChI=1S/C8H13F2NO4/c1-11(4-8(13)14)7(12)2-3-15-5-6(9)10/h6H,2-5H2,1H3,(H,13,14) |
| InChIKey | UQSGQLKIKBUJNE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|