C11H19F2NO4 — CID 103209822
methyl 4-[3-(2,2-difluoroethoxy)propanoyl-methylamino]butanoate (PubChem CID 103209822) has the molecular formula C11H19F2NO4 and a molecular weight of 267.27 g/mol. Its IUPAC name is methyl 4-[3-(2,2-difluoroethoxy)propanoyl-methylamino]butanoate.
| Compound Name | methyl 4-[3-(2,2-difluoroethoxy)propanoyl-methylamino]butanoate |
|---|---|
| PubChem CID | 103209822 |
| Molecular Formula | C11H19F2NO4 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | methyl 4-[3-(2,2-difluoroethoxy)propanoyl-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)C(=O)CCOCC(F)F |
| InChI | InChI=1S/C11H19F2NO4/c1-14(6-3-4-11(16)17-2)10(15)5-7-18-8-9(12)13/h9H,3-8H2,1-2H3 |
| InChIKey | JMRKKDMMWRVFQT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|