C9H18N2O3 — CID 60947887
methyl 4-[methyl-[2-(methylamino)acetyl]amino]butanoate (PubChem CID 60947887) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is methyl 4-[methyl-[2-(methylamino)acetyl]amino]butanoate.
| Compound Name | methyl 4-[methyl-[2-(methylamino)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 60947887 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | methyl 4-[methyl-[2-(methylamino)acetyl]amino]butanoate |
| SMILES | CNCC(=O)N(C)CCCC(=O)OC |
| InChI | InChI=1S/C9H18N2O3/c1-10-7-8(12)11(2)6-4-5-9(13)14-3/h10H,4-7H2,1-3H3 |
| InChIKey | ODBLENOMUDIFLA-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |