C11H22N2O3 — CID 55028566
methyl 4-[tert-butylcarbamoyl(methyl)amino]butanoate (PubChem CID 55028566) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is methyl 4-[tert-butylcarbamoyl(methyl)amino]butanoate.
| Compound Name | methyl 4-[tert-butylcarbamoyl(methyl)amino]butanoate |
|---|---|
| PubChem CID | 55028566 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | methyl 4-[tert-butylcarbamoyl(methyl)amino]butanoate |
| SMILES | COC(=O)CCCN(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H22N2O3/c1-11(2,3)12-10(15)13(4)8-6-7-9(14)16-5/h6-8H2,1-5H3,(H,12,15) |
| InChIKey | FDXQBNRDVFSKRS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |