C16H34N2O — CID 55241774
N-(2-aminoethyl)-3,5,5-trimethyl-N-pentan-3-ylhexanamide (PubChem CID 55241774) has the molecular formula C16H34N2O and a molecular weight of 270.46 g/mol. Its IUPAC name is N-(2-aminoethyl)-3,5,5-trimethyl-N-pentan-3-ylhexanamide.
| Compound Name | N-(2-aminoethyl)-3,5,5-trimethyl-N-pentan-3-ylhexanamide |
|---|---|
| PubChem CID | 55241774 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | N-(2-aminoethyl)-3,5,5-trimethyl-N-pentan-3-ylhexanamide |
| SMILES | CCC(CC)N(CCN)C(=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C16H34N2O/c1-7-14(8-2)18(10-9-17)15(19)11-13(3)12-16(4,5)6/h13-14H,7-12,17H2,1-6H3 |
| InChIKey | GTSZALUJESQDBU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |