C26H55NO2 — CID 87914119
4-(3,5,5-trimethylhexoxy)-N-[4-(3,5,5-trimethylhexoxy)butyl]butan-1-amine (PubChem CID 87914119) has the molecular formula C26H55NO2 and a molecular weight of 413.73 g/mol. Its IUPAC name is 4-(3,5,5-trimethylhexoxy)-N-[4-(3,5,5-trimethylhexoxy)butyl]butan-1-amine.
| Compound Name | 4-(3,5,5-trimethylhexoxy)-N-[4-(3,5,5-trimethylhexoxy)butyl]butan-1-amine |
|---|---|
| PubChem CID | 87914119 |
| Molecular Formula | C26H55NO2 |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 413.42 |
| IUPAC Name | 4-(3,5,5-trimethylhexoxy)-N-[4-(3,5,5-trimethylhexoxy)butyl]butan-1-amine |
| SMILES | CC(CCOCCCCNCCCCOCCC(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C26H55NO2/c1-23(21-25(3,4)5)13-19-28-17-11-9-15-27-16-10-12-18-29-20-14-24(2)22-26(6,7)8/h23-24,27H,9-22H2,1-8H3 |
| InChIKey | ZRDYGMNDCGPPSZ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|