C27H56O4 — CID 58682902
3,5,5-trimethyl-1-[3-[3-[3-(3,5,5-trimethylhexoxy)propoxy]propoxy]propoxy]hexane (PubChem CID 58682902) has the molecular formula C27H56O4 and a molecular weight of 444.74 g/mol. Its IUPAC name is 3,5,5-trimethyl-1-[3-[3-[3-(3,5,5-trimethylhexoxy)propoxy]propoxy]propoxy]hexane.
| Compound Name | 3,5,5-trimethyl-1-[3-[3-[3-(3,5,5-trimethylhexoxy)propoxy]propoxy]propoxy]hexane |
|---|---|
| PubChem CID | 58682902 |
| Molecular Formula | C27H56O4 |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.42 |
| IUPAC Name | 3,5,5-trimethyl-1-[3-[3-[3-(3,5,5-trimethylhexoxy)propoxy]propoxy]propoxy]hexane |
| SMILES | CC(CCOCCCOCCCOCCCOCCC(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C27H56O4/c1-24(22-26(3,4)5)12-20-30-18-10-16-28-14-9-15-29-17-11-19-31-21-13-25(2)23-27(6,7)8/h24-25H,9-23H2,1-8H3 |
| InChIKey | AMWSHWPPSXIDDW-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|