C21H44O2 — CID 141134456
3,5,5-trimethyl-1-[2-(3,5,5-trimethylhexoxy)propan-2-yloxy]hexane (PubChem CID 141134456) has the molecular formula C21H44O2 and a molecular weight of 328.58 g/mol. Its IUPAC name is 3,5,5-trimethyl-1-[2-(3,5,5-trimethylhexoxy)propan-2-yloxy]hexane.
| Compound Name | 3,5,5-trimethyl-1-[2-(3,5,5-trimethylhexoxy)propan-2-yloxy]hexane |
|---|---|
| PubChem CID | 141134456 |
| Molecular Formula | C21H44O2 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 328.33 |
| IUPAC Name | 3,5,5-trimethyl-1-[2-(3,5,5-trimethylhexoxy)propan-2-yloxy]hexane |
| SMILES | CC(CCOC(C)(C)OCCC(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C21H44O2/c1-17(15-19(3,4)5)11-13-22-21(9,10)23-14-12-18(2)16-20(6,7)8/h17-18H,11-16H2,1-10H3 |
| InChIKey | SBIROFRNIBFVJB-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|